CAS 60418-61-3 is the registry number for 2-(3,5-Dimethyl-1H-pyrazol-1-yl)-5-(trifluoromethyl)aniline, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-(3,5-dimethylpyrazol-1-yl)-5-(trifluoromethyl)aniline (CAS 60418-61-3) is a chemical compound with the molecular formula C12H12F3N3 and a molecular weight of 255.24 g/mol. IUPAC name: 2-(3,5-dimethylpyrazol-1-yl)-5-(trifluoromethyl)aniline. InChIKey: JYLBIADCRGRDOY-UHFFFAOYSA-N.
| Molecular formula | C12H12F3N3 |
|---|---|
| Molecular weight | 255.24 g/mol |
| IUPAC name | 2-(3,5-dimethylpyrazol-1-yl)-5-(trifluoromethyl)aniline |
| InChIKey | JYLBIADCRGRDOY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2=C(C=C(C=C2)C(F)(F)F)N)C |
Computed by PubChem (NCBI)