Products 1226268-82-1
CAS 1226268-82-1 is the registry number for 1-(3,4-Dimethylphenyl)-3-(trifluoromethyl)-1H-pyrazol-5-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(3,4-dimethylphenyl)-3-(trifluoromethyl)pyrazol-5-amine (CAS 1226268-82-1) is a chemical compound with the molecular formula C12H12F3N3 and a molecular weight of 255.24 g/mol. IUPAC name: 1-(3,4-dimethylphenyl)-3-(trifluoromethyl)pyrazol-5-amine. InChIKey: AIJSQTXKGROBEN-UHFFFAOYSA-N.
| Molecular formula | C12H12F3N3 |
|---|---|
| Molecular weight | 255.24 g/mol |
| IUPAC name | 1-(3,4-dimethylphenyl)-3-(trifluoromethyl)pyrazol-5-amine |
| InChIKey | AIJSQTXKGROBEN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N2C(=CC(=N2)C(F)(F)F)N)C |
Computed by PubChem (NCBI)