Products 2119583-27-4
CAS 2119583-27-4 appears in our catalog under these names: Nilotinib Impurity 4, 3-(4-Ethyl-1H-imidazol-1-yl)-5-(trifluoromethyl)aniline, 95%, 3-(4-Ethyl-1H-imidazol-1-yl)-5-(trifluoromethyl)aniline. Offered by: Hubei YoungXin, Chemat Brand, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request, 250mg.
3-(4-ethylimidazol-1-yl)-5-(trifluoromethyl)aniline (CAS 2119583-27-4) is a chemical compound with the molecular formula C12H12F3N3 and a molecular weight of 255.24 g/mol. IUPAC name: 3-(4-ethylimidazol-1-yl)-5-(trifluoromethyl)aniline. InChIKey: GXXTYCKSVROUIT-UHFFFAOYSA-N.
| Molecular formula | C12H12F3N3 |
|---|---|
| Molecular weight | 255.24 g/mol |
| IUPAC name | 3-(4-ethylimidazol-1-yl)-5-(trifluoromethyl)aniline |
| InChIKey | GXXTYCKSVROUIT-UHFFFAOYSA-N |
| SMILES | CCC1=CN(C=N1)C2=CC(=CC(=C2)N)C(F)(F)F |
Computed by PubChem (NCBI)