CAS 2119583-28-5 is the registry number for Nilotinib Impurity 2. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
3-(2,4-dimethylimidazol-1-yl)-5-(trifluoromethyl)aniline (CAS 2119583-28-5) is a chemical compound with the molecular formula C12H12F3N3 and a molecular weight of 255.24 g/mol. IUPAC name: 3-(2,4-dimethylimidazol-1-yl)-5-(trifluoromethyl)aniline. InChIKey: PGQQUGRBVCZNRL-UHFFFAOYSA-N.
| Molecular formula | C12H12F3N3 |
|---|---|
| Molecular weight | 255.24 g/mol |
| IUPAC name | 3-(2,4-dimethylimidazol-1-yl)-5-(trifluoromethyl)aniline |
| InChIKey | PGQQUGRBVCZNRL-UHFFFAOYSA-N |
| SMILES | CC1=CN(C(=N1)C)C2=CC(=CC(=C2)N)C(F)(F)F |
Computed by PubChem (NCBI)