Products 2119583-28-5

CAS 2119583-28-5 is the registry number for Nilotinib Impurity 2. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

3-(2,4-dimethylimidazol-1-yl)-5-(trifluoromethyl)aniline (CAS 2119583-28-5) is a chemical compound with the molecular formula C12H12F3N3 and a molecular weight of 255.24 g/mol. IUPAC name: 3-(2,4-dimethylimidazol-1-yl)-5-(trifluoromethyl)aniline. InChIKey: PGQQUGRBVCZNRL-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12F3N3
Molecular weight255.24 g/mol
IUPAC name3-(2,4-dimethylimidazol-1-yl)-5-(trifluoromethyl)aniline
InChIKeyPGQQUGRBVCZNRL-UHFFFAOYSA-N
SMILESCC1=CN(C(=N1)C)C2=CC(=CC(=C2)N)C(F)(F)F

Computed by PubChem (NCBI)