CAS 1005171-96-9 is the registry number for 6-Chloro-4-(trifluoromethyl)pyridine-3-carbaldehyde, 97%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-chloro-4-(trifluoromethyl)pyridine-3-carbaldehyde (CAS 1005171-96-9) is a chemical compound with the molecular formula C7H3ClF3NO and a molecular weight of 209.55 g/mol. IUPAC name: 6-chloro-4-(trifluoromethyl)pyridine-3-carbaldehyde. InChIKey: PAGQSJGQXPGESR-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3NO |
|---|---|
| Molecular weight | 209.55 g/mol |
| IUPAC name | 6-chloro-4-(trifluoromethyl)pyridine-3-carbaldehyde |
| InChIKey | PAGQSJGQXPGESR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Cl)C=O)C(F)(F)F |
Computed by PubChem (NCBI)