Products 1060802-11-0
CAS 1060802-11-0 is the registry number for 1-(5-Chloropyridin-3-yl)-2,2,2-trifluoroethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(5-chloro-3-pyridinyl)-2,2,2-trifluoroethanone (CAS 1060802-11-0) is a chemical compound with the molecular formula C7H3ClF3NO and a molecular weight of 209.55 g/mol. IUPAC name: 1-(5-chloro-3-pyridinyl)-2,2,2-trifluoroethanone. InChIKey: KBKHYZLVWOLSRV-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3NO |
|---|---|
| Molecular weight | 209.55 g/mol |
| IUPAC name | 1-(5-chloro-3-pyridinyl)-2,2,2-trifluoroethanone |
| InChIKey | KBKHYZLVWOLSRV-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC=C1Cl)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)