Products 1057657-62-1
CAS 1057657-62-1 is the registry number for 1-(2-Chloropyridin-3-yl)-2,2,2-trifluoroethanone, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
1-(2-chloro-3-pyridinyl)-2,2,2-trifluoroethanone (CAS 1057657-62-1) is a chemical compound with the molecular formula C7H3ClF3NO and a molecular weight of 209.55 g/mol. IUPAC name: 1-(2-chloro-3-pyridinyl)-2,2,2-trifluoroethanone. InChIKey: OLKLTNDTKRJFEF-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3NO |
|---|---|
| Molecular weight | 209.55 g/mol |
| IUPAC name | 1-(2-chloro-3-pyridinyl)-2,2,2-trifluoroethanone |
| InChIKey | OLKLTNDTKRJFEF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)Cl)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)