CAS 1245914-65-1 appears in our catalog under these names: 6-Chloro-3-(trifluoromethyl)picolinaldehyde, 95%, 6-Chloro-3-(trifluoromethyl)picolinaldehyde, 95+%, 6-Chloro-3-(trifluoromethyl)picolinaldehyde. Offered by: Combi-blocks, AmBeed, TRC. Available pack sizes: 1g, 5g, 250mg.
6-chloro-3-(trifluoromethyl)pyridine-2-carbaldehyde (CAS 1245914-65-1) is a chemical compound with the molecular formula C7H3ClF3NO and a molecular weight of 209.55 g/mol. IUPAC name: 6-chloro-3-(trifluoromethyl)pyridine-2-carbaldehyde. InChIKey: YCRXWHRVPZXEMU-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3NO |
|---|---|
| Molecular weight | 209.55 g/mol |
| IUPAC name | 6-chloro-3-(trifluoromethyl)pyridine-2-carbaldehyde |
| InChIKey | YCRXWHRVPZXEMU-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1C(F)(F)F)C=O)Cl |
Computed by PubChem (NCBI)