Products 128073-05-2
CAS 128073-05-2 appears in our catalog under these names: 5-(TRIFLUOROMETHYL)PYRIDINE-2-CARBONYL &, 5-(Trifluoromethyl)pyridine-2-carbonyl chloride, 95%, 5-(Trifluoromethyl)picolinoyl chloride, 95+%. Offered by: Sigma-Aldrich, Combi-blocks, AmBeed. Available pack sizes: 500MG, 1g, 5g, 250mg.
5-(trifluoromethyl)pyridine-2-carbonyl chloride (CAS 128073-05-2) is a chemical compound with the molecular formula C7H3ClF3NO and a molecular weight of 209.55 g/mol. IUPAC name: 5-(trifluoromethyl)pyridine-2-carbonyl chloride. InChIKey: XGGHEBGOZWCTKF-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3NO |
|---|---|
| Molecular weight | 209.55 g/mol |
| IUPAC name | 5-(trifluoromethyl)pyridine-2-carbonyl chloride |
| InChIKey | XGGHEBGOZWCTKF-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(F)(F)F)C(=O)Cl |
Computed by PubChem (NCBI)