Products 358780-13-9
CAS 358780-13-9 appears in our catalog under these names: 6-(Trifluoromethyl)nicotinoyl chloride, tech grade, 95%, 6–(Trifluoromethyl)nicotinoyl Chloride, 6-(Trifluoromethyl)nicotinoyl chloride 98%, 6-Trifluoromethylnicotinoyl chloride, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 25g, 1g, 5g, 250mg, 10g.
6-(trifluoromethyl)pyridine-3-carbonyl chloride (CAS 358780-13-9) is a chemical compound with the molecular formula C7H3ClF3NO and a molecular weight of 209.55 g/mol. IUPAC name: 6-(trifluoromethyl)pyridine-3-carbonyl chloride. InChIKey: DDIXMUVENCORLG-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3NO |
|---|---|
| Molecular weight | 209.55 g/mol |
| IUPAC name | 6-(trifluoromethyl)pyridine-3-carbonyl chloride |
| InChIKey | DDIXMUVENCORLG-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(=O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
6-(Trifluoromethyl)nicotinoyl chloride, 6-(trifluoromethyl)pyridine-3-carbonyl chloride, 6-Trifluoromethylnicotinoyl chloride, 6-(trifluoromethyl)nicotinoylchloride, 6-(trifluoromethyl)nicotinyl chloride, 6-Trifluoromethyl-nicotinoyl chloride, 6-(trifluoromethyl)-3-pyridinecarbonyl chloride, 3-Pyridinecarbonyl chloride, 6-(trifluoromethyl)-, 6-trifluoromethyl nicotinoyl chloride, 6-(Trifluoromethyl)nicotinoyl Chloride tech.