Products 1005500-77-5
CAS 1005500-77-5 is the registry number for N,4-Dimethyl-N-(phenylethynyl)benzenesulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N,4-dimethyl-N-(2-phenylethynyl)benzenesulfonamide (CAS 1005500-77-5) is a chemical compound with the molecular formula C16H15NO2S and a molecular weight of 285.4 g/mol. IUPAC name: N,4-dimethyl-N-(2-phenylethynyl)benzenesulfonamide. InChIKey: FOAVQZHGNGLPNA-UHFFFAOYSA-N.
| Molecular formula | C16H15NO2S |
|---|---|
| Molecular weight | 285.4 g/mol |
| IUPAC name | N,4-dimethyl-N-(2-phenylethynyl)benzenesulfonamide |
| InChIKey | FOAVQZHGNGLPNA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N(C)C#CC2=CC=CC=C2 |
Computed by PubChem (NCBI)