Products 205885-39-8
CAS 205885-39-8 is the registry number for N-Benzyl-N-ethynyl-4-methylbenzenesulfonamide, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
N-benzyl-N-ethynyl-4-methylbenzenesulfonamide (CAS 205885-39-8) is a chemical compound with the molecular formula C16H15NO2S and a molecular weight of 285.4 g/mol. IUPAC name: N-benzyl-N-ethynyl-4-methylbenzenesulfonamide. InChIKey: VLGDAJJQNOQJRW-UHFFFAOYSA-N.
| Molecular formula | C16H15NO2S |
|---|---|
| Molecular weight | 285.4 g/mol |
| IUPAC name | N-benzyl-N-ethynyl-4-methylbenzenesulfonamide |
| InChIKey | VLGDAJJQNOQJRW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N(CC2=CC=CC=C2)C#C |
Computed by PubChem (NCBI)