Products 611235-55-3
CAS 611235-55-3 is the registry number for 5-(2,6-Dimethoxyphenyl)-2-methylbenzothiazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
5-(2,6-dimethoxyphenyl)-2-methyl-1,3-benzothiazole (CAS 611235-55-3) is a chemical compound with the molecular formula C16H15NO2S and a molecular weight of 285.4 g/mol. IUPAC name: 5-(2,6-dimethoxyphenyl)-2-methyl-1,3-benzothiazole. InChIKey: OHRUTYFECQCTRH-UHFFFAOYSA-N.
| Molecular formula | C16H15NO2S |
|---|---|
| Molecular weight | 285.4 g/mol |
| IUPAC name | 5-(2,6-dimethoxyphenyl)-2-methyl-1,3-benzothiazole |
| InChIKey | OHRUTYFECQCTRH-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(S1)C=CC(=C2)C3=C(C=CC=C3OC)OC |
Computed by PubChem (NCBI)