CAS 1330529-37-7 is the registry number for 1–((Isocyano(p–tolyl)methyl)sulfonyl)–4–methylbenzene. Offered by: GLPBio. Available pack sizes: 1g, 250mg, 5g.
1-[isocyano-(4-methylphenyl)sulfonylmethyl]-4-methylbenzene (CAS 1330529-37-7) is a chemical compound with the molecular formula C16H15NO2S and a molecular weight of 285.4 g/mol. IUPAC name: 1-[isocyano-(4-methylphenyl)sulfonylmethyl]-4-methylbenzene. InChIKey: LFYGLAKFGVOWQS-UHFFFAOYSA-N.
| Molecular formula | C16H15NO2S |
|---|---|
| Molecular weight | 285.4 g/mol |
| IUPAC name | 1-[isocyano-(4-methylphenyl)sulfonylmethyl]-4-methylbenzene |
| InChIKey | LFYGLAKFGVOWQS-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C([N+]#[C-])S(=O)(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)