Products 58379-86-5
CAS 58379-86-5 appears in our catalog under these names: 1-Benzyl-1-tosylmethyl isocyanide, 97%, 1–Benzyl–1–tosylmethylisocyanide, 1-Benzyl-1-tosylmethylisocyanide 95%, 1-((1-Isocyano-2-phenylethyl)sulfonyl)-4-methylbenzene, 95%,RG. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
1-(1-isocyano-2-phenylethyl)sulfonyl-4-methylbenzene (CAS 58379-86-5) is a chemical compound with the molecular formula C16H15NO2S and a molecular weight of 285.4 g/mol. IUPAC name: 1-(1-isocyano-2-phenylethyl)sulfonyl-4-methylbenzene. InChIKey: XBGXGWNKJBMMPR-UHFFFAOYSA-N.
| Molecular formula | C16H15NO2S |
|---|---|
| Molecular weight | 285.4 g/mol |
| IUPAC name | 1-(1-isocyano-2-phenylethyl)sulfonyl-4-methylbenzene |
| InChIKey | XBGXGWNKJBMMPR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C(CC2=CC=CC=C2)[N+]#[C-] |
Computed by PubChem (NCBI)