CAS 1225327-16-1 appears in our catalog under these names: Eletriptan Impurity 10, Des-dimethylpyrrolidine Eletriptan, >95% (HPLC), 5-(2-(Benzenesulfonyl)ethyl)-1H-indole, 95%, 5-(2-(Benzenesulfonyl)ethyl)-1H-indole. Offered by: Chemat Brand, TRC, AmBeed, Biosynth. Available pack sizes: on request, 100mg, 250mg, 25mg, 1g, 50mg, 0,5g.
5-[2-(benzenesulfonyl)ethyl]-1H-indole (CAS 1225327-16-1) is a chemical compound with the molecular formula C16H15NO2S and a molecular weight of 285.4 g/mol. IUPAC name: 5-[2-(benzenesulfonyl)ethyl]-1H-indole. InChIKey: FRWWPACTWAVMMU-UHFFFAOYSA-N.
| Molecular formula | C16H15NO2S |
|---|---|
| Molecular weight | 285.4 g/mol |
| IUPAC name | 5-[2-(benzenesulfonyl)ethyl]-1H-indole |
| InChIKey | FRWWPACTWAVMMU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)CCC2=CC3=C(C=C2)NC=C3 |
Computed by PubChem (NCBI)