CAS 100606-60-8 is the registry number for Lenvatinib Impurity 104. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
4-amino-2,3,5-trichlorophenol (CAS 100606-60-8) is a chemical compound with the molecular formula C6H4Cl3NO and a molecular weight of 212.5 g/mol. IUPAC name: 4-amino-2,3,5-trichlorophenol. InChIKey: YGRJIROAZIHLIG-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl3NO |
|---|---|
| Molecular weight | 212.5 g/mol |
| IUPAC name | 4-amino-2,3,5-trichlorophenol |
| InChIKey | YGRJIROAZIHLIG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)N)Cl)Cl)O |
Computed by PubChem (NCBI)