Products 66608-11-5

CAS 66608-11-5 is the registry number for 6-CHLORONICOTINOYL CHLORIDE, 97%. Offered by: Sigma-Aldrich. Available pack sizes: 25G.

Structural formula: {0} (CAS {1})

6-chloropyridine-3-carbonyl chloride;hydrochloride (CAS 66608-11-5) is a chemical compound with the molecular formula C6H4Cl3NO and a molecular weight of 212.5 g/mol. IUPAC name: 6-chloropyridine-3-carbonyl chloride;hydrochloride. InChIKey: NGDJIWMBLGYWEG-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4Cl3NO
Molecular weight212.5 g/mol
IUPAC name6-chloropyridine-3-carbonyl chloride;hydrochloride
InChIKeyNGDJIWMBLGYWEG-UHFFFAOYSA-N
SMILESC1=CC(=NC=C1C(=O)Cl)Cl.Cl

Computed by PubChem (NCBI)