CAS 66608-11-5 is the registry number for 6-CHLORONICOTINOYL CHLORIDE, 97%. Offered by: Sigma-Aldrich. Available pack sizes: 25G.
6-chloropyridine-3-carbonyl chloride;hydrochloride (CAS 66608-11-5) is a chemical compound with the molecular formula C6H4Cl3NO and a molecular weight of 212.5 g/mol. IUPAC name: 6-chloropyridine-3-carbonyl chloride;hydrochloride. InChIKey: NGDJIWMBLGYWEG-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl3NO |
|---|---|
| Molecular weight | 212.5 g/mol |
| IUPAC name | 6-chloropyridine-3-carbonyl chloride;hydrochloride |
| InChIKey | NGDJIWMBLGYWEG-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(=O)Cl)Cl.Cl |
Computed by PubChem (NCBI)