CAS 6358-15-2 appears in our catalog under these names: 2-Amino-3,4,6-trichlorophenol, 2-Amino-3,4,6-trichlorophenol, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 5g.
2-amino-3,4,6-trichlorophenol (CAS 6358-15-2) is a chemical compound with the molecular formula C6H4Cl3NO and a molecular weight of 212.5 g/mol. IUPAC name: 2-amino-3,4,6-trichlorophenol. InChIKey: QQDKXJSYZGJGKJ-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl3NO |
|---|---|
| Molecular weight | 212.5 g/mol |
| IUPAC name | 2-amino-3,4,6-trichlorophenol |
| InChIKey | QQDKXJSYZGJGKJ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)Cl)N)O)Cl |
Computed by PubChem (NCBI)