CAS 51727-15-2 appears in our catalog under these names: 4-Chloropyridine-2-carbonyl chloride hydrochloride, 95%, 4-Chloropicolinoyl chloride hydrochloride, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
4-chloropyridine-2-carbonyl chloride;hydrochloride (CAS 51727-15-2) is a chemical compound with the molecular formula C6H4Cl3NO and a molecular weight of 212.5 g/mol. IUPAC name: 4-chloropyridine-2-carbonyl chloride;hydrochloride. InChIKey: HJQLQTVZSPAUGT-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl3NO |
|---|---|
| Molecular weight | 212.5 g/mol |
| IUPAC name | 4-chloropyridine-2-carbonyl chloride;hydrochloride |
| InChIKey | HJQLQTVZSPAUGT-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1Cl)C(=O)Cl.Cl |
Computed by PubChem (NCBI)