Products 64981-10-8

CAS 64981-10-8 is the registry number for Lenvatinib Impurity 94. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

4-amino-2,3,6-trichlorophenol (CAS 64981-10-8) is a chemical compound with the molecular formula C6H4Cl3NO and a molecular weight of 212.5 g/mol. IUPAC name: 4-amino-2,3,6-trichlorophenol. InChIKey: SDDSYHWCKPQNAZ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4Cl3NO
Molecular weight212.5 g/mol
IUPAC name4-amino-2,3,6-trichlorophenol
InChIKeySDDSYHWCKPQNAZ-UHFFFAOYSA-N
SMILESC1=C(C(=C(C(=C1Cl)O)Cl)Cl)N

Computed by PubChem (NCBI)