Products 55483-86-8
CAS 55483-86-8 is the registry number for (2,5,6-trichloropyridin-3-yl)methanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(2,5,6-trichloro-3-pyridinyl)methanol (CAS 55483-86-8) is a chemical compound with the molecular formula C6H4Cl3NO and a molecular weight of 212.5 g/mol. IUPAC name: (2,5,6-trichloro-3-pyridinyl)methanol. InChIKey: DIKOCDNAUXARJW-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl3NO |
|---|---|
| Molecular weight | 212.5 g/mol |
| IUPAC name | (2,5,6-trichloro-3-pyridinyl)methanol |
| InChIKey | DIKOCDNAUXARJW-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=C1Cl)Cl)Cl)CO |
Computed by PubChem (NCBI)