Products 1006348-95-3
CAS 1006348-95-3 is the registry number for 5-((3-Amino-1H-pyrazol-1-yl)methyl)furan-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-[(3-aminopyrazol-1-yl)methyl]furan-2-carboxylic acid (CAS 1006348-95-3) is a chemical compound with the molecular formula C9H9N3O3 and a molecular weight of 207.19 g/mol. IUPAC name: 5-[(3-aminopyrazol-1-yl)methyl]furan-2-carboxylic acid. InChIKey: ZQIYSCQZTGKEHH-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O3 |
|---|---|
| Molecular weight | 207.19 g/mol |
| IUPAC name | 5-[(3-aminopyrazol-1-yl)methyl]furan-2-carboxylic acid |
| InChIKey | ZQIYSCQZTGKEHH-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1N)CC2=CC=C(O2)C(=O)O |
Computed by PubChem (NCBI)