Products 1006473-31-9

CAS 1006473-31-9 is the registry number for 4-Chloro-1-(1H-pyrazol-1-ylmethyl)-1H-pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

4-chloro-1-(pyrazol-1-ylmethyl)pyrazole-3-carboxylic acid (CAS 1006473-31-9) is a chemical compound with the molecular formula C8H7ClN4O2 and a molecular weight of 226.62 g/mol. IUPAC name: 4-chloro-1-(pyrazol-1-ylmethyl)pyrazole-3-carboxylic acid. InChIKey: VVYFVYPPRVLBSG-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7ClN4O2
Molecular weight226.62 g/mol
IUPAC name4-chloro-1-(pyrazol-1-ylmethyl)pyrazole-3-carboxylic acid
InChIKeyVVYFVYPPRVLBSG-UHFFFAOYSA-N
SMILESC1=CN(N=C1)CN2C=C(C(=N2)C(=O)O)Cl

Computed by PubChem (NCBI)