CAS 862893-33-2 is the registry number for 7-Allyl-8-chloro-1H-purine-2,6(3H,7H)-dione, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
8-chloro-7-prop-2-enyl-3H-purine-2,6-dione (CAS 862893-33-2) is a chemical compound with the molecular formula C8H7ClN4O2 and a molecular weight of 226.62 g/mol. IUPAC name: 8-chloro-7-prop-2-enyl-3H-purine-2,6-dione. InChIKey: KOZZYIHVPUEIPB-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN4O2 |
|---|---|
| Molecular weight | 226.62 g/mol |
| IUPAC name | 8-chloro-7-prop-2-enyl-3H-purine-2,6-dione |
| InChIKey | KOZZYIHVPUEIPB-UHFFFAOYSA-N |
| SMILES | C=CCN1C2=C(NC(=O)NC2=O)N=C1Cl |
Computed by PubChem (NCBI)