CAS 1422344-01-1 is the registry number for Ethyl 8-chloro-(1,2,4)triazolo(1,5-a)pyrazine-2-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 250mg.
Ethyl 8-chloro-[1,2,4]triazolo[1,5-a]pyrazine-2-carboxylate (CAS 1422344-01-1) is a chemical compound with the molecular formula C8H7ClN4O2 and a molecular weight of 226.62 g/mol. IUPAC name: ethyl 8-chloro-[1,2,4]triazolo[1,5-a]pyrazine-2-carboxylate. InChIKey: UIOYEOFIQIJXLG-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN4O2 |
|---|---|
| Molecular weight | 226.62 g/mol |
| IUPAC name | ethyl 8-chloro-[1,2,4]triazolo[1,5-a]pyrazine-2-carboxylate |
| InChIKey | UIOYEOFIQIJXLG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN2C=CN=C(C2=N1)Cl |
Computed by PubChem (NCBI)