CAS 1694341-67-7 appears in our catalog under these names: 3-(5-(Chloromethyl)-1,2,4-oxadiazol-3-yl)-6-methoxypyridazine, 98%, 3-(5-(Chloromethyl)-1,2,4-oxadiazol-3-yl)-6-methoxypyridazine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
5-(chloromethyl)-3-(6-methoxypyridazin-3-yl)-1,2,4-oxadiazole (CAS 1694341-67-7) is a chemical compound with the molecular formula C8H7ClN4O2 and a molecular weight of 226.62 g/mol. IUPAC name: 5-(chloromethyl)-3-(6-methoxypyridazin-3-yl)-1,2,4-oxadiazole. InChIKey: QXRLYKBDVLSQEA-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN4O2 |
|---|---|
| Molecular weight | 226.62 g/mol |
| IUPAC name | 5-(chloromethyl)-3-(6-methoxypyridazin-3-yl)-1,2,4-oxadiazole |
| InChIKey | QXRLYKBDVLSQEA-UHFFFAOYSA-N |
| SMILES | COC1=NN=C(C=C1)C2=NOC(=N2)CCl |
Computed by PubChem (NCBI)