CAS 1416222-84-8 is the registry number for Methyl 6-chloro-3-methyl-[1,2,4]triazolo[4,3-b]pyridazine-8-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 6-chloro-3-methyl-[1,2,4]triazolo[4,3-b]pyridazine-8-carboxylate (CAS 1416222-84-8) is a chemical compound with the molecular formula C8H7ClN4O2 and a molecular weight of 226.62 g/mol. IUPAC name: methyl 6-chloro-3-methyl-[1,2,4]triazolo[4,3-b]pyridazine-8-carboxylate. InChIKey: CPYMTHXUQANKOX-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN4O2 |
|---|---|
| Molecular weight | 226.62 g/mol |
| IUPAC name | methyl 6-chloro-3-methyl-[1,2,4]triazolo[4,3-b]pyridazine-8-carboxylate |
| InChIKey | CPYMTHXUQANKOX-UHFFFAOYSA-N |
| SMILES | CC1=NN=C2N1N=C(C=C2C(=O)OC)Cl |
Computed by PubChem (NCBI)