CAS 1311314-55-2 is the registry number for Methyl 2-{4-chloro-1H-pyrazolo(3,4-d)pyrimidin-1-yl}acetate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Methyl 2-(4-chloropyrazolo[5,4-d]pyrimidin-1-yl)acetate (CAS 1311314-55-2) is a chemical compound with the molecular formula C8H7ClN4O2 and a molecular weight of 226.62 g/mol. IUPAC name: methyl 2-(4-chloropyrazolo[5,4-d]pyrimidin-1-yl)acetate. InChIKey: DXGYHPGWRMBPBX-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN4O2 |
|---|---|
| Molecular weight | 226.62 g/mol |
| IUPAC name | methyl 2-(4-chloropyrazolo[5,4-d]pyrimidin-1-yl)acetate |
| InChIKey | DXGYHPGWRMBPBX-UHFFFAOYSA-N |
| SMILES | COC(=O)CN1C2=C(C=N1)C(=NC=N2)Cl |
Computed by PubChem (NCBI)