Products 1006487-34-8
CAS 1006487-34-8 is the registry number for 1-[(3-Bromophenoxy)methyl]-1h-pyrazole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-[(3-bromophenoxy)methyl]pyrazole-3-carboxylic acid (CAS 1006487-34-8) is a chemical compound with the molecular formula C11H9BrN2O3 and a molecular weight of 297.10 g/mol. IUPAC name: 1-[(3-bromophenoxy)methyl]pyrazole-3-carboxylic acid. InChIKey: VXBGTLMJHCWAAF-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN2O3 |
|---|---|
| Molecular weight | 297.10 g/mol |
| IUPAC name | 1-[(3-bromophenoxy)methyl]pyrazole-3-carboxylic acid |
| InChIKey | VXBGTLMJHCWAAF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)OCN2C=CC(=N2)C(=O)O |
Computed by PubChem (NCBI)