Products 889946-79-6
CAS 889946-79-6 is the registry number for 3-[3-(2-Bromophenyl)-1,2,4-oxadiazol-5-yl]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-[3-(2-bromophenyl)-1,2,4-oxadiazol-5-yl]propanoic acid (CAS 889946-79-6) is a chemical compound with the molecular formula C11H9BrN2O3 and a molecular weight of 297.10 g/mol. IUPAC name: 3-[3-(2-bromophenyl)-1,2,4-oxadiazol-5-yl]propanoic acid. InChIKey: QRTXQLGCNGCFMH-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN2O3 |
|---|---|
| Molecular weight | 297.10 g/mol |
| IUPAC name | 3-[3-(2-bromophenyl)-1,2,4-oxadiazol-5-yl]propanoic acid |
| InChIKey | QRTXQLGCNGCFMH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NOC(=N2)CCC(=O)O)Br |
Computed by PubChem (NCBI)