CAS 1206800-77-2 is the registry number for 1-Acetyl-5-(acetyloxy)-6-bromo-1h-indazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(1-acetyl-6-bromoindazol-5-yl) acetate (CAS 1206800-77-2) is a chemical compound with the molecular formula C11H9BrN2O3 and a molecular weight of 297.10 g/mol. IUPAC name: (1-acetyl-6-bromoindazol-5-yl) acetate. InChIKey: ULMJHNMTKSEWKX-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN2O3 |
|---|---|
| Molecular weight | 297.10 g/mol |
| IUPAC name | (1-acetyl-6-bromoindazol-5-yl) acetate |
| InChIKey | ULMJHNMTKSEWKX-UHFFFAOYSA-N |
| SMILES | CC(=O)N1C2=CC(=C(C=C2C=N1)OC(=O)C)Br |
Computed by PubChem (NCBI)