CAS 1480815-26-6 is the registry number for ethyl 5-bromo-8-hydroxy-1,6-naphthyridine-7-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 5-bromo-8-hydroxy-1,6-naphthyridine-7-carboxylate (CAS 1480815-26-6) is a chemical compound with the molecular formula C11H9BrN2O3 and a molecular weight of 297.10 g/mol. IUPAC name: ethyl 5-bromo-8-hydroxy-1,6-naphthyridine-7-carboxylate. InChIKey: DBMJXZFJGLFUNH-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN2O3 |
|---|---|
| Molecular weight | 297.10 g/mol |
| IUPAC name | ethyl 5-bromo-8-hydroxy-1,6-naphthyridine-7-carboxylate |
| InChIKey | DBMJXZFJGLFUNH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(C=CC=N2)C(=N1)Br)O |
Computed by PubChem (NCBI)