Products 102118-19-4
CAS 102118-19-4 appears in our catalog under these names: 3-(6-Bromo-4-oxoquinazolin-3(4h)-yl)propanoic acid, 95%, 3-(6-bromo-4-oxo-3,4-dihydroquinazolin-3-yl)propanoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
3-(6-bromo-4-oxoquinazolin-3-yl)propanoic acid (CAS 102118-19-4) is a chemical compound with the molecular formula C11H9BrN2O3 and a molecular weight of 297.10 g/mol. IUPAC name: 3-(6-bromo-4-oxoquinazolin-3-yl)propanoic acid. InChIKey: AEZBMKGUVYPCAR-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN2O3 |
|---|---|
| Molecular weight | 297.10 g/mol |
| IUPAC name | 3-(6-bromo-4-oxoquinazolin-3-yl)propanoic acid |
| InChIKey | AEZBMKGUVYPCAR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=O)N(C=N2)CCC(=O)O |
Computed by PubChem (NCBI)