CAS 223711-74-8 is the registry number for Ethyl 7-bromo-3-oxo-3,4-dihydroquinoxaline-2-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 50mg.
Ethyl 7-bromo-3-oxo-4H-quinoxaline-2-carboxylate (CAS 223711-74-8) is a chemical compound with the molecular formula C11H9BrN2O3 and a molecular weight of 297.10 g/mol. IUPAC name: ethyl 7-bromo-3-oxo-4H-quinoxaline-2-carboxylate. InChIKey: AKIIAQCJJOJJDB-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN2O3 |
|---|---|
| Molecular weight | 297.10 g/mol |
| IUPAC name | ethyl 7-bromo-3-oxo-4H-quinoxaline-2-carboxylate |
| InChIKey | AKIIAQCJJOJJDB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC2=C(C=CC(=C2)Br)NC1=O |
Computed by PubChem (NCBI)