CAS 1006614-50-1 appears in our catalog under these names: trans-2-(3,4-Difluorophenyl)cyclopropanecarboxylic acid, 98%, trans–2–(3，4–difluorophenyl)cyclopropane–1–carboxylic acid, trans-2-(3,4-Difluoro-phenyl)-cyclopropanecarboxylic acid. Offered by: AmBeed, GLPBio, Biosynth. Available pack sizes: 5g, 1g, 500mg, 0,5g, 50mg.
Trans-(1R,2R)-2-(3,4-difluorophenyl)cyclopropane-1-carboxylic acid (CAS 1006614-50-1) is a chemical compound with the molecular formula C10H8F2O2 and a molecular weight of 198.17 g/mol. IUPAC name: trans-(1R,2R)-2-(3,4-difluorophenyl)cyclopropane-1-carboxylic acid. InChIKey: CSLVZAGSOJLXCT-NKWVEPMBSA-N.
| Molecular formula | C10H8F2O2 |
|---|---|
| Molecular weight | 198.17 g/mol |
| IUPAC name | trans-(1R,2R)-2-(3,4-difluorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | CSLVZAGSOJLXCT-NKWVEPMBSA-N |
| SMILES | C1[C@H]([C@@H]1C(=O)O)C2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)