CAS 1007229-11-9 appears in our catalog under these names: 2-Bromo-n-[4-(trifluoromethyl)benzyl]acetamide, 95%, 2-Bromo-N-(4-(trifluoromethyl)benzyl)acetamide 95%, 2-Bromo-N-(4-(trifluoromethyl)benzyl)acetamide, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg.
2-bromo-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide (CAS 1007229-11-9) is a chemical compound with the molecular formula C10H9BrF3NO and a molecular weight of 296.08 g/mol. IUPAC name: 2-bromo-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide. InChIKey: PMBLWFQYQPOXHG-UHFFFAOYSA-N.
| Molecular formula | C10H9BrF3NO |
|---|---|
| Molecular weight | 296.08 g/mol |
| IUPAC name | 2-bromo-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide |
| InChIKey | PMBLWFQYQPOXHG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CNC(=O)CBr)C(F)(F)F |
Computed by PubChem (NCBI)