Products 2504202-78-0
CAS 2504202-78-0 is the registry number for 3-Bromo-n-ethyl-4-(trifluoromethyl)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-bromo-N-ethyl-4-(trifluoromethyl)benzamide (CAS 2504202-78-0) is a chemical compound with the molecular formula C10H9BrF3NO and a molecular weight of 296.08 g/mol. IUPAC name: 3-bromo-N-ethyl-4-(trifluoromethyl)benzamide. InChIKey: SZLRBOAUSLDMSF-UHFFFAOYSA-N.
| Molecular formula | C10H9BrF3NO |
|---|---|
| Molecular weight | 296.08 g/mol |
| IUPAC name | 3-bromo-N-ethyl-4-(trifluoromethyl)benzamide |
| InChIKey | SZLRBOAUSLDMSF-UHFFFAOYSA-N |
| SMILES | CCNC(=O)C1=CC(=C(C=C1)C(F)(F)F)Br |
Computed by PubChem (NCBI)