Products 1369932-49-9
CAS 1369932-49-9 is the registry number for 3-Bromo-n,n-dimethyl-5-(trifluoromethyl)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-bromo-N,N-dimethyl-5-(trifluoromethyl)benzamide (CAS 1369932-49-9) is a chemical compound with the molecular formula C10H9BrF3NO and a molecular weight of 296.08 g/mol. IUPAC name: 3-bromo-N,N-dimethyl-5-(trifluoromethyl)benzamide. InChIKey: QJYXDZZITDOSQY-UHFFFAOYSA-N.
| Molecular formula | C10H9BrF3NO |
|---|---|
| Molecular weight | 296.08 g/mol |
| IUPAC name | 3-bromo-N,N-dimethyl-5-(trifluoromethyl)benzamide |
| InChIKey | QJYXDZZITDOSQY-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC(=CC(=C1)Br)C(F)(F)F |
Computed by PubChem (NCBI)