CAS 864725-41-7 is the registry number for 4-Bromo-2-methyl-n-(2,2,2-trifluoro-ethyl)-benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-bromo-2-methyl-N-(2,2,2-trifluoroethyl)benzamide (CAS 864725-41-7) is a chemical compound with the molecular formula C10H9BrF3NO and a molecular weight of 296.08 g/mol. IUPAC name: 4-bromo-2-methyl-N-(2,2,2-trifluoroethyl)benzamide. InChIKey: GZDNDRHHNXGAIW-UHFFFAOYSA-N.
| Molecular formula | C10H9BrF3NO |
|---|---|
| Molecular weight | 296.08 g/mol |
| IUPAC name | 4-bromo-2-methyl-N-(2,2,2-trifluoroethyl)benzamide |
| InChIKey | GZDNDRHHNXGAIW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Br)C(=O)NCC(F)(F)F |
Computed by PubChem (NCBI)