CAS 1057246-44-2 appears in our catalog under these names: N-[2-(2-bromophenyl)ethyl]-2,2,2-trifluoroacetamide, 98%, N–(2–bromophenethyl)–2,2,2–trifluoroacetamide. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 200mg.
N-[2-(2-bromophenyl)ethyl]-2,2,2-trifluoroacetamide (CAS 1057246-44-2) is a chemical compound with the molecular formula C10H9BrF3NO and a molecular weight of 296.08 g/mol. IUPAC name: N-[2-(2-bromophenyl)ethyl]-2,2,2-trifluoroacetamide. InChIKey: QSRMSKQYDZYJCN-UHFFFAOYSA-N.
| Molecular formula | C10H9BrF3NO |
|---|---|
| Molecular weight | 296.08 g/mol |
| IUPAC name | N-[2-(2-bromophenyl)ethyl]-2,2,2-trifluoroacetamide |
| InChIKey | QSRMSKQYDZYJCN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CCNC(=O)C(F)(F)F)Br |
Computed by PubChem (NCBI)