Products 1016798-70-1
CAS 1016798-70-1 is the registry number for N-(4-Bromo-3-methylphenyl)-3,3,3-trifluoropropanamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(4-bromo-3-methylphenyl)-3,3,3-trifluoropropanamide (CAS 1016798-70-1) is a chemical compound with the molecular formula C10H9BrF3NO and a molecular weight of 296.08 g/mol. IUPAC name: N-(4-bromo-3-methylphenyl)-3,3,3-trifluoropropanamide. InChIKey: IBKMOUJJKLNGHC-UHFFFAOYSA-N.
| Molecular formula | C10H9BrF3NO |
|---|---|
| Molecular weight | 296.08 g/mol |
| IUPAC name | N-(4-bromo-3-methylphenyl)-3,3,3-trifluoropropanamide |
| InChIKey | IBKMOUJJKLNGHC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)NC(=O)CC(F)(F)F)Br |
Computed by PubChem (NCBI)