CAS 100724-39-8 is the registry number for N-Hydroxy-4-(phenylsulfonyl)benzimidamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(benzenesulfonyl)-N'-hydroxybenzenecarboximidamide (CAS 100724-39-8) is a chemical compound with the molecular formula C13H12N2O3S and a molecular weight of 276.31 g/mol. IUPAC name: 4-(benzenesulfonyl)-N'-hydroxybenzenecarboximidamide. InChIKey: CCLKIXFLRIXKTO-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O3S |
|---|---|
| Molecular weight | 276.31 g/mol |
| IUPAC name | 4-(benzenesulfonyl)-N'-hydroxybenzenecarboximidamide |
| InChIKey | CCLKIXFLRIXKTO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)C2=CC=C(C=C2)/C(=N/O)/N |
Computed by PubChem (NCBI)