Products 21501-24-6
CAS 21501-24-6 appears in our catalog under these names: Dapsone Impurity 17 (N-Formyl Dapsone), Dapsone Impurity 13, N-formyl Dapsone, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg, 50mg.
N-[4-(4-aminophenyl)sulfonylphenyl]formamide (CAS 21501-24-6) is a chemical compound with the molecular formula C13H12N2O3S and a molecular weight of 276.31 g/mol. IUPAC name: N-[4-(4-aminophenyl)sulfonylphenyl]formamide. InChIKey: OUBLSNZSHXQKRB-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O3S |
|---|---|
| Molecular weight | 276.31 g/mol |
| IUPAC name | N-[4-(4-aminophenyl)sulfonylphenyl]formamide |
| InChIKey | OUBLSNZSHXQKRB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)S(=O)(=O)C2=CC=C(C=C2)NC=O |
Computed by PubChem (NCBI)