CAS 2173101-00-1 is the registry number for 1-(4-Methyl-1,3-benzothiazol-2-yl)-5-oxopyrrolidine-3-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
1-(4-methyl-1,3-benzothiazol-2-yl)-5-oxopyrrolidine-3-carboxylic acid (CAS 2173101-00-1) is a chemical compound with the molecular formula C13H12N2O3S and a molecular weight of 276.31 g/mol. IUPAC name: 1-(4-methyl-1,3-benzothiazol-2-yl)-5-oxopyrrolidine-3-carboxylic acid. InChIKey: KTIJOTGMHYOOIH-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O3S |
|---|---|
| Molecular weight | 276.31 g/mol |
| IUPAC name | 1-(4-methyl-1,3-benzothiazol-2-yl)-5-oxopyrrolidine-3-carboxylic acid |
| InChIKey | KTIJOTGMHYOOIH-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)SC(=N2)N3CC(CC3=O)C(=O)O |
Computed by PubChem (NCBI)