Products 1254588-01-6
CAS 1254588-01-6 appears in our catalog under these names: 2-(3-Benzylureido)thiophene-3-carboxylic acid, 95%, 2-(3-Benzylureido)thiophene-3-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2-(benzylcarbamoylamino)thiophene-3-carboxylic acid (CAS 1254588-01-6) is a chemical compound with the molecular formula C13H12N2O3S and a molecular weight of 276.31 g/mol. IUPAC name: 2-(benzylcarbamoylamino)thiophene-3-carboxylic acid. InChIKey: SOTFAQCASSGVMA-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O3S |
|---|---|
| Molecular weight | 276.31 g/mol |
| IUPAC name | 2-(benzylcarbamoylamino)thiophene-3-carboxylic acid |
| InChIKey | SOTFAQCASSGVMA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC(=O)NC2=C(C=CS2)C(=O)O |
Computed by PubChem (NCBI)