Products 24099-02-3

CAS 24099-02-3 is the registry number for [(4-Formyl-3-methyl-1-phenyl-1h-pyrazol-5-yl)thio]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

2-(4-formyl-3-methyl-1-phenylpyrazol-5-yl)sulfanylacetic acid (CAS 24099-02-3) is a chemical compound with the molecular formula C13H12N2O3S and a molecular weight of 276.31 g/mol. IUPAC name: 2-(4-formyl-3-methyl-1-phenylpyrazol-5-yl)sulfanylacetic acid. InChIKey: DEBIAWJFAYKQPZ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H12N2O3S
Molecular weight276.31 g/mol
IUPAC name2-(4-formyl-3-methyl-1-phenylpyrazol-5-yl)sulfanylacetic acid
InChIKeyDEBIAWJFAYKQPZ-UHFFFAOYSA-N
SMILESCC1=NN(C(=C1C=O)SCC(=O)O)C2=CC=CC=C2

Computed by PubChem (NCBI)