CAS 2378582-39-7 is the registry number for 3-(4-Mercapto-1-oxoisoindolin-2-yl)piperidine-2,6-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3-oxo-7-sulfanyl-1H-isoindol-2-yl)piperidine-2,6-dione (CAS 2378582-39-7) is a chemical compound with the molecular formula C13H12N2O3S and a molecular weight of 276.31 g/mol. IUPAC name: 3-(3-oxo-7-sulfanyl-1H-isoindol-2-yl)piperidine-2,6-dione. InChIKey: AWXCFZRHPUBHBO-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O3S |
|---|---|
| Molecular weight | 276.31 g/mol |
| IUPAC name | 3-(3-oxo-7-sulfanyl-1H-isoindol-2-yl)piperidine-2,6-dione |
| InChIKey | AWXCFZRHPUBHBO-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C=CC=C3S |
Computed by PubChem (NCBI)