CAS 100726-66-7 is the registry number for 2,4-Dichloro-6-((phenylamino)methyl)phenol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(anilinomethyl)-4,6-dichlorophenol (CAS 100726-66-7) is a chemical compound with the molecular formula C13H11Cl2NO and a molecular weight of 268.13 g/mol. IUPAC name: 2-(anilinomethyl)-4,6-dichlorophenol. InChIKey: RPQIKHYWFFZVIZ-UHFFFAOYSA-N.
| Molecular formula | C13H11Cl2NO |
|---|---|
| Molecular weight | 268.13 g/mol |
| IUPAC name | 2-(anilinomethyl)-4,6-dichlorophenol |
| InChIKey | RPQIKHYWFFZVIZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NCC2=C(C(=CC(=C2)Cl)Cl)O |
Computed by PubChem (NCBI)