Products 1881296-16-7
CAS 1881296-16-7 is the registry number for 3-(4,5-dichloro-2-methylphenoxymethyl)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-[(4,5-dichloro-2-methylphenoxy)methyl]pyridine (CAS 1881296-16-7) is a chemical compound with the molecular formula C13H11Cl2NO and a molecular weight of 268.13 g/mol. IUPAC name: 3-[(4,5-dichloro-2-methylphenoxy)methyl]pyridine. InChIKey: PYVGAHGYIUKXAE-UHFFFAOYSA-N.
| Molecular formula | C13H11Cl2NO |
|---|---|
| Molecular weight | 268.13 g/mol |
| IUPAC name | 3-[(4,5-dichloro-2-methylphenoxy)methyl]pyridine |
| InChIKey | PYVGAHGYIUKXAE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1OCC2=CN=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)